About (E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine
(E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine (PubChem CID 59351019) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is (E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine.
Molecular Properties
| Compound Name | (E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine |
| PubChem CID | 59351019 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine |
| SMILES | CC(C)(C)C/C(=N\N)C1CCCCC1 |
| InChI | InChI=1S/C12H24N2/c1-12(2,3)9-11(14-13)10-7-5-4-6-8-10/h10H,4-9,13H2,1-3H3/b14-11+ |
| InChIKey | FJCPFYXFCFZHJX-SDNWHVSQSA-N |
| XLogP | 3.32 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine?
The IUPAC name of (E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine (CID 59351019) is (E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine.
What is the SMILES notation for (E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine?
The canonical SMILES for (E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine is CC(C)(C)C/C(=N\N)C1CCCCC1.
What is the InChIKey of (E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine?
The InChIKey is FJCPFYXFCFZHJX-SDNWHVSQSA-N. The full InChI is InChI=1S/C12H24N2/c1-12(2,3)9-11(14-13)10-7-5-4-6-8-10/h10H,4-9,13H2,1-3H3/b14-11+.
What are the key properties of (E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine?
(E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine has a molecular weight of 196.34 g/mol, XLogP of 3.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-(1-cyclohexyl-3,3-dimethylbutylidene)hydrazine is sourced from PubChem (CID 59351019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).