C13H17F3N2 — CID 59351059
N-[(Z)-(3,3-dimethyl-1-phenylbutylidene)amino]-1,1,1-trifluoromethanamine (PubChem CID 59351059) has the molecular formula C13H17F3N2 and a molecular weight of 258.29 g/mol. Its IUPAC name is N-[(Z)-(3,3-dimethyl-1-phenylbutylidene)amino]-1,1,1-trifluoromethanamine.
| Compound Name | N-[(Z)-(3,3-dimethyl-1-phenylbutylidene)amino]-1,1,1-trifluoromethanamine |
|---|---|
| PubChem CID | 59351059 |
| Molecular Formula | C13H17F3N2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | N-[(Z)-(3,3-dimethyl-1-phenylbutylidene)amino]-1,1,1-trifluoromethanamine |
| SMILES | CC(C)(C)C/C(=N/NC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H17F3N2/c1-12(2,3)9-11(17-18-13(14,15)16)10-7-5-4-6-8-10/h4-8,18H,9H2,1-3H3/b17-11- |
| InChIKey | NHZJKOFCCLUITP-BOPFTXTBSA-N |
| XLogP | 3.94 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|