C10H13FN2O — CID 59351280
cis-(1R,3S)-3-(3-fluoropyrazin-2-yl)cyclohexan-1-ol (PubChem CID 59351280) has the molecular formula C10H13FN2O and a molecular weight of 196.22 g/mol. Its IUPAC name is cis-(1R,3S)-3-(3-fluoropyrazin-2-yl)cyclohexan-1-ol.
| Compound Name | cis-(1R,3S)-3-(3-fluoropyrazin-2-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 59351280 |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | cis-(1R,3S)-3-(3-fluoropyrazin-2-yl)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCC[C@H](c2nccnc2F)C1 |
| InChI | InChI=1S/C10H13FN2O/c11-10-9(12-4-5-13-10)7-2-1-3-8(14)6-7/h4-5,7-8,14H,1-3,6H2/t7-,8+/m0/s1 |
| InChIKey | CEHASAOMFLHOAO-JGVFFNPUSA-N |
| XLogP | 1.63 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |