About N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine
N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine (PubChem CID 59351321) has the molecular formula C24H16N6OS
and a molecular weight of 436.50 g/mol. Its IUPAC name is N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine |
| PubChem CID | 59351321 |
| Molecular Formula | C24H16N6OS |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine |
| SMILES | c1ccc2sc(Nc3ccc(Oc4nccnc4-c4cnc5[nH]ccc5c4)cc3)nc2c1 |
| InChI | InChI=1S/C24H16N6OS/c1-2-4-20-19(3-1)30-24(32-20)29-17-5-7-18(8-6-17)31-23-21(25-11-12-27-23)16-13-15-9-10-26-22(15)28-14-16/h1-14H,(H,26,28)(H,29,30) |
| InChIKey | ATENDXXEJREQQT-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine?
The IUPAC name of N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine (CID 59351321) is N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine?
The canonical SMILES for N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine is c1ccc2sc(Nc3ccc(Oc4nccnc4-c4cnc5[nH]ccc5c4)cc3)nc2c1.
What is the InChIKey of N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine?
The InChIKey is ATENDXXEJREQQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16N6OS/c1-2-4-20-19(3-1)30-24(32-20)29-17-5-7-18(8-6-17)31-23-21(25-11-12-27-23)16-13-15-9-10-26-22(15)28-14-16/h1-14H,(H,26,28)(H,29,30).
What are the key properties of N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine?
N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine has a molecular weight of 436.50 g/mol, XLogP of 6.17, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazin-2-yl]oxyphenyl]-1,3-benzothiazol-2-amine is sourced from PubChem (CID 59351321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).