About methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate
methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate (PubChem CID 59351712) has the molecular formula C12H14N2O4S
and a molecular weight of 282.32 g/mol. Its IUPAC name is methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate.
Molecular Properties
| Compound Name | methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate |
| PubChem CID | 59351712 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate |
| SMILES | CCc1cc2c(=O)n(C(C)C(=O)OC)c(=O)[nH]c2s1 |
| InChI | InChI=1S/C12H14N2O4S/c1-4-7-5-8-9(19-7)13-12(17)14(10(8)15)6(2)11(16)18-3/h5-6H,4H2,1-3H3,(H,13,17) |
| InChIKey | OAGVOCICZQJVCN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate?
The IUPAC name of methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate (CID 59351712) is methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate.
What is the SMILES notation for methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate?
The canonical SMILES for methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate is CCc1cc2c(=O)n(C(C)C(=O)OC)c(=O)[nH]c2s1.
What is the InChIKey of methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate?
The InChIKey is OAGVOCICZQJVCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O4S/c1-4-7-5-8-9(19-7)13-12(17)14(10(8)15)6(2)11(16)18-3/h5-6H,4H2,1-3H3,(H,13,17).
What are the key properties of methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate?
methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate has a molecular weight of 282.32 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-ethyl-2,4-dioxo-1H-thieno[2,3-d]pyrimidin-3-yl)propanoate is sourced from PubChem (CID 59351712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).