C11H11N3O5S — CID 59351837
[(3S)-5,11-dioxo-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-trien-3-yl]methyl methanesulfonate (PubChem CID 59351837) has the molecular formula C11H11N3O5S and a molecular weight of 297.29 g/mol. Its IUPAC name is [(3S)-5,11-dioxo-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-trien-3-yl]methyl methanesulfonate.
| Compound Name | [(3S)-5,11-dioxo-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-trien-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 59351837 |
| Molecular Formula | C11H11N3O5S |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | [(3S)-5,11-dioxo-1,4,7-triazatricyclo[6.3.1.04,12]dodeca-6,8(12),9-trien-3-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@H]1Cn2c(=O)ccc3ncc(=O)n1c32 |
| InChI | InChI=1S/C11H11N3O5S/c1-20(17,18)19-6-7-5-13-9(15)3-2-8-11(13)14(7)10(16)4-12-8/h2-4,7H,5-6H2,1H3/t7-/m0/s1 |
| InChIKey | SAQZMDPXNCOPGY-ZETCQYMHSA-N |
| XLogP | -0.91 |
| TPSA | 100.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|