C12H22O5 — CID 59351912
(2R,3R,5R,6S)-5-ethyl-2,3-dimethoxy-2,3-dimethyl-6-(oxiran-2-yl)-1,4-dioxane (PubChem CID 59351912) has the molecular formula C12H22O5 and a molecular weight of 246.30 g/mol. Its IUPAC name is (2R,3R,5R,6S)-5-ethyl-2,3-dimethoxy-2,3-dimethyl-6-(oxiran-2-yl)-1,4-dioxane.
| Compound Name | (2R,3R,5R,6S)-5-ethyl-2,3-dimethoxy-2,3-dimethyl-6-(oxiran-2-yl)-1,4-dioxane |
|---|---|
| PubChem CID | 59351912 |
| Molecular Formula | C12H22O5 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (2R,3R,5R,6S)-5-ethyl-2,3-dimethoxy-2,3-dimethyl-6-(oxiran-2-yl)-1,4-dioxane |
| SMILES | CC[C@H]1O[C@@](C)(OC)[C@](C)(OC)O[C@@H]1C1CO1 |
| InChI | InChI=1S/C12H22O5/c1-6-8-10(9-7-15-9)17-12(3,14-5)11(2,13-4)16-8/h8-10H,6-7H2,1-5H3/t8-,9?,10+,11-,12-/m1/s1 |
| InChIKey | ZBXWOMURXTYWCJ-RJJYYCBPSA-N |
| XLogP | 1.30 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|