About 3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one
3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one (PubChem CID 59351917) has the molecular formula C24H24NO2P
and a molecular weight of 389.44 g/mol. Its IUPAC name is 3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one |
| PubChem CID | 59351917 |
| Molecular Formula | C24H24NO2P |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one |
| SMILES | CN1CC(CC=P(c2ccccc2)(c2ccccc2)c2ccccc2)OC1=O |
| InChI | InChI=1S/C24H24NO2P/c1-25-19-20(27-24(25)26)17-18-28(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,18,20H,17,19H2,1H3 |
| InChIKey | YPIRCZGCXKCPJC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one?
The IUPAC name of 3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one (CID 59351917) is 3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one is CN1CC(CC=P(c2ccccc2)(c2ccccc2)c2ccccc2)OC1=O.
What is the InChIKey of 3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one?
The InChIKey is YPIRCZGCXKCPJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24NO2P/c1-25-19-20(27-24(25)26)17-18-28(21-11-5-2-6-12-21,22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,18,20H,17,19H2,1H3.
What are the key properties of 3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one?
3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one has a molecular weight of 389.44 g/mol, XLogP of 3.62, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-[2-(triphenyl-λ5-phosphanylidene)ethyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 59351917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).