C12H22O4 — CID 59351925
(2R,3R,5R,6R)-5-ethenyl-6-ethyl-2,3-dimethoxy-2,3-dimethyl-1,4-dioxane (PubChem CID 59351925) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (2R,3R,5R,6R)-5-ethenyl-6-ethyl-2,3-dimethoxy-2,3-dimethyl-1,4-dioxane.
| Compound Name | (2R,3R,5R,6R)-5-ethenyl-6-ethyl-2,3-dimethoxy-2,3-dimethyl-1,4-dioxane |
|---|---|
| PubChem CID | 59351925 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (2R,3R,5R,6R)-5-ethenyl-6-ethyl-2,3-dimethoxy-2,3-dimethyl-1,4-dioxane |
| SMILES | C=C[C@H]1O[C@@](C)(OC)[C@](C)(OC)O[C@@H]1CC |
| InChI | InChI=1S/C12H22O4/c1-7-9-10(8-2)16-12(4,14-6)11(3,13-5)15-9/h7,9-10H,1,8H2,2-6H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | AJVCQSZHLLMFJZ-DDHJBXDOSA-N |
| XLogP | 2.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|