C12H17NO5 — CID 59351956
(7aR)-2-(3-hydroxy-2-methoxypropyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 59351956) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is (7aR)-2-(3-hydroxy-2-methoxypropyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (7aR)-2-(3-hydroxy-2-methoxypropyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 59351956 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | (7aR)-2-(3-hydroxy-2-methoxypropyl)-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | COC(CO)CN1C(=O)C2C3CCC(O3)[C@@H]2C1=O |
| InChI | InChI=1S/C12H17NO5/c1-17-6(5-14)4-13-11(15)9-7-2-3-8(18-7)10(9)12(13)16/h6-10,14H,2-5H2,1H3/t6?,7?,8?,9-,10?/m0/s1 |
| InChIKey | YPAJEWNNCLEEJT-SPWRCNBUSA-N |
| XLogP | -0.84 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|