C13H17N2OP — CID 59352034
1'-methyl-1-phosphanylspiro[indole-3,4'-piperidine]-2-one (PubChem CID 59352034) has the molecular formula C13H17N2OP and a molecular weight of 248.27 g/mol. Its IUPAC name is 1'-methyl-1-phosphanylspiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 1'-methyl-1-phosphanylspiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 59352034 |
| Molecular Formula | C13H17N2OP |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1'-methyl-1-phosphanylspiro[indole-3,4'-piperidine]-2-one |
| SMILES | CN1CCC2(CC1)C(=O)N(P)c1ccccc12 |
| InChI | InChI=1S/C13H17N2OP/c1-14-8-6-13(7-9-14)10-4-2-3-5-11(10)15(17)12(13)16/h2-5H,6-9,17H2,1H3 |
| InChIKey | WZPLWSFHQZEESR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|