About 5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one
5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one (PubChem CID 59352317) has the molecular formula C22H17FN2O3
and a molecular weight of 376.39 g/mol. Its IUPAC name is 5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one |
| PubChem CID | 59352317 |
| Molecular Formula | C22H17FN2O3 |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one |
| SMILES | COc1cc2c(cc1F)C1(CO2)C(=O)N(Cc2ccccn2)c2ccccc21 |
| InChI | InChI=1S/C22H17FN2O3/c1-27-20-11-19-16(10-17(20)23)22(13-28-19)15-7-2-3-8-18(15)25(21(22)26)12-14-6-4-5-9-24-14/h2-11H,12-13H2,1H3 |
| InChIKey | VKUBDXJMQPXASM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one?
The IUPAC name of 5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one (CID 59352317) is 5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one.
What is the SMILES notation for 5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one?
The canonical SMILES for 5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one is COc1cc2c(cc1F)C1(CO2)C(=O)N(Cc2ccccn2)c2ccccc21.
What is the InChIKey of 5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one?
The InChIKey is VKUBDXJMQPXASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17FN2O3/c1-27-20-11-19-16(10-17(20)23)22(13-28-19)15-7-2-3-8-18(15)25(21(22)26)12-14-6-4-5-9-24-14/h2-11H,12-13H2,1H3.
What are the key properties of 5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one?
5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one has a molecular weight of 376.39 g/mol, XLogP of 3.45, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-methoxy-1'-(pyridin-2-ylmethyl)spiro[2H-1-benzofuran-3,3'-indole]-2'-one is sourced from PubChem (CID 59352317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).