C25H18F3NO7 — CID 59352361
6-[[5-(trifluoromethyl)furan-2-yl]methyl]spiro[2,3-dihydro-[1,4]dioxino[2,3-f]indole-8,8'-3,7-dihydro-2H-furo[2,3-g][1,4]benzodioxine]-7-one (PubChem CID 59352361) has the molecular formula C25H18F3NO7 and a molecular weight of 501.41 g/mol. Its IUPAC name is 6-[[5-(trifluoromethyl)furan-2-yl]methyl]spiro[2,3-dihydro-[1,4]dioxino[2,3-f]indole-8,8'-3,7-dihydro-2H-furo[2,3-g][1,4]benzodioxine]-7-one.
| Compound Name | 6-[[5-(trifluoromethyl)furan-2-yl]methyl]spiro[2,3-dihydro-[1,4]dioxino[2,3-f]indole-8,8'-3,7-dihydro-2H-furo[2,3-g][1,4]benzodioxine]-7-one |
|---|---|
| PubChem CID | 59352361 |
| Molecular Formula | C25H18F3NO7 |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 501.10 |
| IUPAC Name | 6-[[5-(trifluoromethyl)furan-2-yl]methyl]spiro[2,3-dihydro-[1,4]dioxino[2,3-f]indole-8,8'-3,7-dihydro-2H-furo[2,3-g][1,4]benzodioxine]-7-one |
| SMILES | O=C1N(Cc2ccc(C(F)(F)F)o2)c2cc3c(cc2C12COc1cc4c(cc12)OCCO4)OCCO3 |
| InChI | InChI=1S/C25H18F3NO7/c26-25(27,28)22-2-1-13(36-22)11-29-16-9-20-18(31-3-5-33-20)7-14(16)24(23(29)30)12-35-17-10-21-19(8-15(17)24)32-4-6-34-21/h1-2,7-10H,3-6,11-12H2 |
| InChIKey | MPAMGMDXCSGZNZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |