About 2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde
2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde (PubChem CID 59352677) has the molecular formula C17H13NO3
and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde |
| PubChem CID | 59352677 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde |
| SMILES | O=CCN1C(=O)C2(COc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C17H13NO3/c19-10-9-18-14-7-3-1-5-12(14)17(16(18)20)11-21-15-8-4-2-6-13(15)17/h1-8,10H,9,11H2 |
| InChIKey | WXJCWBQXGKUYCO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde?
The IUPAC name of 2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde (CID 59352677) is 2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde.
What is the SMILES notation for 2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde?
The canonical SMILES for 2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde is O=CCN1C(=O)C2(COc3ccccc32)c2ccccc21.
What is the InChIKey of 2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde?
The InChIKey is WXJCWBQXGKUYCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13NO3/c19-10-9-18-14-7-3-1-5-12(14)17(16(18)20)11-21-15-8-4-2-6-13(15)17/h1-8,10H,9,11H2.
What are the key properties of 2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde?
2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde has a molecular weight of 279.30 g/mol, XLogP of 1.91, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetaldehyde is sourced from PubChem (CID 59352677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).