C16H18N6O3S — CID 59352805
1-ethyl-3-[5-(2-methoxyethoxy)-6-pyrimidin-5-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea (PubChem CID 59352805) has the molecular formula C16H18N6O3S and a molecular weight of 374.43 g/mol. Its IUPAC name is 1-ethyl-3-[5-(2-methoxyethoxy)-6-pyrimidin-5-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea.
| Compound Name | 1-ethyl-3-[5-(2-methoxyethoxy)-6-pyrimidin-5-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea |
|---|---|
| PubChem CID | 59352805 |
| Molecular Formula | C16H18N6O3S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 1-ethyl-3-[5-(2-methoxyethoxy)-6-pyrimidin-5-yl-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2cc(-c3cncnc3)c(OCCOC)nc2s1 |
| InChI | InChI=1S/C16H18N6O3S/c1-3-19-15(23)22-16-20-12-6-11(10-7-17-9-18-8-10)13(21-14(12)26-16)25-5-4-24-2/h6-9H,3-5H2,1-2H3,(H2,19,20,22,23) |
| InChIKey | DFUGRSJYZFEARP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|