C11H11BrN4O2 — CID 59352826
1-(6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-yl)-3-prop-2-enylurea (PubChem CID 59352826) has the molecular formula C11H11BrN4O2 and a molecular weight of 311.14 g/mol. Its IUPAC name is 1-(6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-yl)-3-prop-2-enylurea.
| Compound Name | 1-(6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-yl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 59352826 |
| Molecular Formula | C11H11BrN4O2 |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 1-(6-bromo-5-methyl-[1,3]oxazolo[5,4-b]pyridin-2-yl)-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1nc2cc(Br)c(C)nc2o1 |
| InChI | InChI=1S/C11H11BrN4O2/c1-3-4-13-10(17)16-11-15-8-5-7(12)6(2)14-9(8)18-11/h3,5H,1,4H2,2H3,(H2,13,15,16,17) |
| InChIKey | QUXCMABRIDNQBF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|