C20H22FN5O3S — CID 59352830
1-ethyl-3-[6-(6-fluoro-3-pyridinyl)-5-(oxan-4-ylmethoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea (PubChem CID 59352830) has the molecular formula C20H22FN5O3S and a molecular weight of 431.49 g/mol. Its IUPAC name is 1-ethyl-3-[6-(6-fluoro-3-pyridinyl)-5-(oxan-4-ylmethoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea.
| Compound Name | 1-ethyl-3-[6-(6-fluoro-3-pyridinyl)-5-(oxan-4-ylmethoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea |
|---|---|
| PubChem CID | 59352830 |
| Molecular Formula | C20H22FN5O3S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 1-ethyl-3-[6-(6-fluoro-3-pyridinyl)-5-(oxan-4-ylmethoxy)-[1,3]thiazolo[5,4-b]pyridin-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2cc(-c3ccc(F)nc3)c(OCC3CCOCC3)nc2s1 |
| InChI | InChI=1S/C20H22FN5O3S/c1-2-22-19(27)26-20-24-15-9-14(13-3-4-16(21)23-10-13)17(25-18(15)30-20)29-11-12-5-7-28-8-6-12/h3-4,9-10,12H,2,5-8,11H2,1H3,(H2,22,24,26,27) |
| InChIKey | SHQMJPYCGLBPPI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|