C25H25ClFN7OS — CID 59352869
2-chloro-N-[4-[4-[(Z)-[(Z)-1,3-diaminobut-2-enylidene]amino]-6-[(3S)-3-fluoropyrrolidin-1-yl]pyrimidin-2-yl]sulfanylphenyl]benzamide (PubChem CID 59352869) has the molecular formula C25H25ClFN7OS and a molecular weight of 526.04 g/mol. Its IUPAC name is 2-chloro-N-[4-[4-[(Z)-[(Z)-1,3-diaminobut-2-enylidene]amino]-6-[(3S)-3-fluoropyrrolidin-1-yl]pyrimidin-2-yl]sulfanylphenyl]benzamide.
| Compound Name | 2-chloro-N-[4-[4-[(Z)-[(Z)-1,3-diaminobut-2-enylidene]amino]-6-[(3S)-3-fluoropyrrolidin-1-yl]pyrimidin-2-yl]sulfanylphenyl]benzamide |
|---|---|
| PubChem CID | 59352869 |
| Molecular Formula | C25H25ClFN7OS |
| Molecular Weight | 526.04 g/mol |
| Exact Mass | 525.15 |
| IUPAC Name | 2-chloro-N-[4-[4-[(Z)-[(Z)-1,3-diaminobut-2-enylidene]amino]-6-[(3S)-3-fluoropyrrolidin-1-yl]pyrimidin-2-yl]sulfanylphenyl]benzamide |
| SMILES | C/C(N)=C/C(N)=N/c1cc(N2CC[C@H](F)C2)nc(Sc2ccc(NC(=O)c3ccccc3Cl)cc2)n1 |
| InChI | InChI=1S/C25H25ClFN7OS/c1-15(28)12-21(29)31-22-13-23(34-11-10-16(27)14-34)33-25(32-22)36-18-8-6-17(7-9-18)30-24(35)19-4-2-3-5-20(19)26/h2-9,12-13,16H,10-11,14,28H2,1H3,(H,30,35)(H2,29,31,32,33)/b15-12-/t16-/m0/s1 |
| InChIKey | AFYCITYNZPNPMA-IRVMHKCDSA-N |
| XLogP | 4.93 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.04 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|