C21H19F5N6OS2 — CID 59352879
N-[4-[4-(3,3-difluoropyrrolidin-1-yl)-6-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide (PubChem CID 59352879) has the molecular formula C21H19F5N6OS2 and a molecular weight of 530.55 g/mol. Its IUPAC name is N-[4-[4-(3,3-difluoropyrrolidin-1-yl)-6-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[4-[4-(3,3-difluoropyrrolidin-1-yl)-6-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 59352879 |
| Molecular Formula | C21H19F5N6OS2 |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | N-[4-[4-(3,3-difluoropyrrolidin-1-yl)-6-[(5-methyl-1,3-thiazol-2-yl)amino]pyrimidin-2-yl]sulfanylphenyl]-3,3,3-trifluoropropanamide |
| SMILES | Cc1cnc(Nc2cc(N3CCC(F)(F)C3)nc(Sc3ccc(NC(=O)CC(F)(F)F)cc3)n2)s1 |
| InChI | InChI=1S/C21H19F5N6OS2/c1-12-10-27-18(34-12)29-15-8-16(32-7-6-20(22,23)11-32)31-19(30-15)35-14-4-2-13(3-5-14)28-17(33)9-21(24,25)26/h2-5,8,10H,6-7,9,11H2,1H3,(H,28,33)(H,27,29,30,31) |
| InChIKey | LRAFLOGMTPLAKP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |