C22H30N8OS — CID 59352906
N-[4-[4-[(Z)-[(Z)-1,3-diaminobut-2-enylidene]amino]-6-[(3S)-3-(methylamino)pyrrolidin-1-yl]pyrimidin-2-yl]sulfanylphenyl]propanamide (PubChem CID 59352906) has the molecular formula C22H30N8OS and a molecular weight of 454.60 g/mol. Its IUPAC name is N-[4-[4-[(Z)-[(Z)-1,3-diaminobut-2-enylidene]amino]-6-[(3S)-3-(methylamino)pyrrolidin-1-yl]pyrimidin-2-yl]sulfanylphenyl]propanamide.
| Compound Name | N-[4-[4-[(Z)-[(Z)-1,3-diaminobut-2-enylidene]amino]-6-[(3S)-3-(methylamino)pyrrolidin-1-yl]pyrimidin-2-yl]sulfanylphenyl]propanamide |
|---|---|
| PubChem CID | 59352906 |
| Molecular Formula | C22H30N8OS |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | N-[4-[4-[(Z)-[(Z)-1,3-diaminobut-2-enylidene]amino]-6-[(3S)-3-(methylamino)pyrrolidin-1-yl]pyrimidin-2-yl]sulfanylphenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(Sc2nc(/N=C(N)/C=C(/C)N)cc(N3CC[C@H](NC)C3)n2)cc1 |
| InChI | InChI=1S/C22H30N8OS/c1-4-21(31)26-15-5-7-17(8-6-15)32-22-28-19(27-18(24)11-14(2)23)12-20(29-22)30-10-9-16(13-30)25-3/h5-8,11-12,16,25H,4,9-10,13,23H2,1-3H3,(H,26,31)(H2,24,27,28,29)/b14-11-/t16-/m0/s1 |
| InChIKey | ZGFHYDLZGVJQEA-QBOMHBFWSA-N |
| XLogP | 2.63 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|