About 4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane
4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane (PubChem CID 59352970) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane.
Molecular Properties
| Compound Name | 4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane |
| PubChem CID | 59352970 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane |
| SMILES | CC1CC2CC3(C1)CC3N2C |
| InChI | InChI=1S/C10H17N/c1-7-3-8-5-10(4-7)6-9(10)11(8)2/h7-9H,3-6H2,1-2H3 |
| InChIKey | YSDWFZBMTXGSEP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane?
The IUPAC name of 4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane (CID 59352970) is 4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane.
What is the SMILES notation for 4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane?
The canonical SMILES for 4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane is CC1CC2CC3(C1)CC3N2C.
What is the InChIKey of 4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane?
The InChIKey is YSDWFZBMTXGSEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-7-3-8-5-10(4-7)6-9(10)11(8)2/h7-9H,3-6H2,1-2H3.
What are the key properties of 4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane?
4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane has a molecular weight of 151.25 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dimethyl-4-azatricyclo[3.3.1.01,3]nonane is sourced from PubChem (CID 59352970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).