About 5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine
5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine (PubChem CID 59353304) has the molecular formula C12H14BrN5O2
and a molecular weight of 340.18 g/mol. Its IUPAC name is 5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine |
| PubChem CID | 59353304 |
| Molecular Formula | C12H14BrN5O2 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine |
| SMILES | COc1cc(Nc2ncc(Br)c(NN)n2)cc(OC)c1 |
| InChI | InChI=1S/C12H14BrN5O2/c1-19-8-3-7(4-9(5-8)20-2)16-12-15-6-10(13)11(17-12)18-14/h3-6H,14H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | KCKOJWIQDRWMIV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine?
The IUPAC name of 5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine (CID 59353304) is 5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine.
What is the SMILES notation for 5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine?
The canonical SMILES for 5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine is COc1cc(Nc2ncc(Br)c(NN)n2)cc(OC)c1.
What is the InChIKey of 5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine?
The InChIKey is KCKOJWIQDRWMIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN5O2/c1-19-8-3-7(4-9(5-8)20-2)16-12-15-6-10(13)11(17-12)18-14/h3-6H,14H2,1-2H3,(H2,15,16,17,18).
What are the key properties of 5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine?
5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine has a molecular weight of 340.18 g/mol, XLogP of 2.29, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(3,5-dimethoxyphenyl)-4-hydrazinylpyrimidin-2-amine is sourced from PubChem (CID 59353304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).