C22H14Cl2FN5O2 — CID 59353947
(E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-(4-chloropyrazol-1-yl)pyrimidin-5-yl]phenyl]prop-2-enoic acid (PubChem CID 59353947) has the molecular formula C22H14Cl2FN5O2 and a molecular weight of 470.29 g/mol. Its IUPAC name is (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-(4-chloropyrazol-1-yl)pyrimidin-5-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-(4-chloropyrazol-1-yl)pyrimidin-5-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 59353947 |
| Molecular Formula | C22H14Cl2FN5O2 |
| Molecular Weight | 470.29 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | (E)-3-[3-[2-(3-chloro-4-fluoroanilino)-4-(4-chloropyrazol-1-yl)pyrimidin-5-yl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(-c2cnc(Nc3ccc(F)c(Cl)c3)nc2-n2cc(Cl)cn2)c1 |
| InChI | InChI=1S/C22H14Cl2FN5O2/c23-15-10-27-30(12-15)21-17(14-3-1-2-13(8-14)4-7-20(31)32)11-26-22(29-21)28-16-5-6-19(25)18(24)9-16/h1-12H,(H,31,32)(H,26,28,29)/b7-4+ |
| InChIKey | KNFSMJNCJLIMDN-QPJJXVBHSA-N |
| XLogP | 5.62 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.29 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|