About 5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine
5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine (PubChem CID 59353993) has the molecular formula C11H8BrF2N3S
and a molecular weight of 332.17 g/mol. Its IUPAC name is 5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine |
| PubChem CID | 59353993 |
| Molecular Formula | C11H8BrF2N3S |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine |
| SMILES | CSc1nc(Nc2ccc(F)c(F)c2)ncc1Br |
| InChI | InChI=1S/C11H8BrF2N3S/c1-18-10-7(12)5-15-11(17-10)16-6-2-3-8(13)9(14)4-6/h2-5H,1H3,(H,15,16,17) |
| InChIKey | WNCTZEBIVCZTOJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine?
The IUPAC name of 5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine (CID 59353993) is 5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine.
What is the SMILES notation for 5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine?
The canonical SMILES for 5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine is CSc1nc(Nc2ccc(F)c(F)c2)ncc1Br.
What is the InChIKey of 5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine?
The InChIKey is WNCTZEBIVCZTOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrF2N3S/c1-18-10-7(12)5-15-11(17-10)16-6-2-3-8(13)9(14)4-6/h2-5H,1H3,(H,15,16,17).
What are the key properties of 5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine?
5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine has a molecular weight of 332.17 g/mol, XLogP of 3.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(3,4-difluorophenyl)-4-methylsulfanylpyrimidin-2-amine is sourced from PubChem (CID 59353993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).