About ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate
ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate (PubChem CID 593545) has the molecular formula C11H16N4O3
and a molecular weight of 252.27 g/mol. Its IUPAC name is ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate |
| PubChem CID | 593545 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ncn[nH]2)CC1 |
| InChI | InChI=1S/C11H16N4O3/c1-2-18-11(17)8-3-5-15(6-4-8)10(16)9-12-7-13-14-9/h7-8H,2-6H2,1H3,(H,12,13,14) |
| InChIKey | KHBMJZZUSLMAPP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate?
The IUPAC name of ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate (CID 593545) is ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate.
What is the SMILES notation for ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate?
The canonical SMILES for ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate is CCOC(=O)C1CCN(C(=O)c2ncn[nH]2)CC1.
What is the InChIKey of ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate?
The InChIKey is KHBMJZZUSLMAPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O3/c1-2-18-11(17)8-3-5-15(6-4-8)10(16)9-12-7-13-14-9/h7-8H,2-6H2,1H3,(H,12,13,14).
What are the key properties of ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate?
ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate has a molecular weight of 252.27 g/mol, XLogP of 0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-(1H-1,2,4-triazole-5-carbonyl)piperidine-4-carboxylate is sourced from PubChem (CID 593545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).