About methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate
methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate (PubChem CID 59354919) has the molecular formula C11H11F3N2O3
and a molecular weight of 276.21 g/mol. Its IUPAC name is methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate |
| PubChem CID | 59354919 |
| Molecular Formula | C11H11F3N2O3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)NCCC(F)(F)F)nc1 |
| InChI | InChI=1S/C11H11F3N2O3/c1-19-10(18)7-2-3-8(16-6-7)9(17)15-5-4-11(12,13)14/h2-3,6H,4-5H2,1H3,(H,15,17) |
| InChIKey | LRBWHQFCOMZTHP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate?
The IUPAC name of methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate (CID 59354919) is methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate?
The canonical SMILES for methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate is COC(=O)c1ccc(C(=O)NCCC(F)(F)F)nc1.
What is the InChIKey of methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate?
The InChIKey is LRBWHQFCOMZTHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3N2O3/c1-19-10(18)7-2-3-8(16-6-7)9(17)15-5-4-11(12,13)14/h2-3,6H,4-5H2,1H3,(H,15,17).
What are the key properties of methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate?
methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate has a molecular weight of 276.21 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(3,3,3-trifluoropropylcarbamoyl)pyridine-3-carboxylate is sourced from PubChem (CID 59354919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).