About 1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine
1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine (PubChem CID 59355367) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine.
Molecular Properties
| Compound Name | 1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine |
| PubChem CID | 59355367 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine |
| SMILES | C=C(C)N1CC=CCN1C |
| InChI | InChI=1S/C8H14N2/c1-8(2)10-7-5-4-6-9(10)3/h4-5H,1,6-7H2,2-3H3 |
| InChIKey | ZYXRDBSWQBWYJG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine?
The IUPAC name of 1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine (CID 59355367) is 1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine.
What is the SMILES notation for 1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine?
The canonical SMILES for 1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine is C=C(C)N1CC=CCN1C.
What is the InChIKey of 1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine?
The InChIKey is ZYXRDBSWQBWYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-8(2)10-7-5-4-6-9(10)3/h4-5H,1,6-7H2,2-3H3.
What are the key properties of 1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine?
1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine has a molecular weight of 138.21 g/mol, XLogP of 1.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-prop-1-en-2-yl-3,6-dihydropyridazine is sourced from PubChem (CID 59355367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).