About CID 59355519
CID 59355519 (PubChem CID 59355519) has the molecular formula C12H8BrN
and a molecular weight of 246.11 g/mol.
Molecular Properties
| Compound Name | CID 59355519 |
| PubChem CID | 59355519 |
| Molecular Formula | C12H8BrN |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | — |
| SMILES | [CH]c1cc2nc(Br)ccc2c(C)c1[CH] |
| InChI | InChI=1S/C12H8BrN/c1-7-6-11-10(9(3)8(7)2)4-5-12(13)14-11/h1-2,4-6H,3H3 |
| InChIKey | YKBOFXGMHUUNFM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze CID 59355519 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59355519?
The IUPAC name of CID 59355519 (CID 59355519) is not available.
What is the SMILES notation for CID 59355519?
The canonical SMILES for CID 59355519 is [CH]c1cc2nc(Br)ccc2c(C)c1[CH].
What is the InChIKey of CID 59355519?
The InChIKey is YKBOFXGMHUUNFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8BrN/c1-7-6-11-10(9(3)8(7)2)4-5-12(13)14-11/h1-2,4-6H,3H3.
What are the key properties of CID 59355519?
CID 59355519 has a molecular weight of 246.11 g/mol, XLogP of 3.42, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59355519 is sourced from PubChem (CID 59355519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).