About CID 59355527
CID 59355527 (PubChem CID 59355527) has the molecular formula C12H5BrF3N
and a molecular weight of 300.08 g/mol.
Molecular Properties
| Compound Name | CID 59355527 |
| PubChem CID | 59355527 |
| Molecular Formula | C12H5BrF3N |
| Molecular Weight | 300.08 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | — |
| SMILES | [CH]c1nc2cc(C(F)(F)F)ccc2c(Br)c1[CH] |
| InChI | InChI=1S/C12H5BrF3N/c1-6-7(2)17-10-5-8(12(14,15)16)3-4-9(10)11(6)13/h1-5H |
| InChIKey | DONUGDDYMKPWER-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.08 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 59355527 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59355527?
The IUPAC name of CID 59355527 (CID 59355527) is not available.
What is the SMILES notation for CID 59355527?
The canonical SMILES for CID 59355527 is [CH]c1nc2cc(C(F)(F)F)ccc2c(Br)c1[CH].
What is the InChIKey of CID 59355527?
The InChIKey is DONUGDDYMKPWER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5BrF3N/c1-6-7(2)17-10-5-8(12(14,15)16)3-4-9(10)11(6)13/h1-5H.
What are the key properties of CID 59355527?
CID 59355527 has a molecular weight of 300.08 g/mol, XLogP of 4.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59355527 is sourced from PubChem (CID 59355527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).