C13H20O5 — CID 59355586
(6aR)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one (PubChem CID 59355586) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (6aR)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (6aR)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 59355586 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (6aR)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one |
| SMILES | CC1(C)OCC(C2CC(=O)C3OC(C)(C)O[C@@H]32)O1 |
| InChI | InChI=1S/C13H20O5/c1-12(2)15-6-9(16-12)7-5-8(14)11-10(7)17-13(3,4)18-11/h7,9-11H,5-6H2,1-4H3/t7?,9?,10-,11?/m1/s1 |
| InChIKey | QTHJBEGJVIMFBY-PTPFUDFOSA-N |
| XLogP | 1.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |