About 5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole
5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole (PubChem CID 59355619) has the molecular formula C17H11Cl2F3N2O3
and a molecular weight of 419.19 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
| PubChem CID | 59355619 |
| Molecular Formula | C17H11Cl2F3N2O3 |
| Molecular Weight | 419.19 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole |
| SMILES | Cc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11Cl2F3N2O3/c1-9-2-3-10(4-15(9)24(25)26)14-8-16(27-23-14,17(20,21)22)11-5-12(18)7-13(19)6-11/h2-7H,8H2,1H3 |
| InChIKey | ZYCHIUXHSJPQJK-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.19 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
The IUPAC name of 5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole (CID 59355619) is 5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole.
What is the SMILES notation for 5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
The canonical SMILES for 5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole is Cc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1[N+](=O)[O-].
What is the InChIKey of 5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
The InChIKey is ZYCHIUXHSJPQJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl2F3N2O3/c1-9-2-3-10(4-15(9)24(25)26)14-8-16(27-23-14,17(20,21)22)11-5-12(18)7-13(19)6-11/h2-7H,8H2,1H3.
What are the key properties of 5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole?
5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole has a molecular weight of 419.19 g/mol, XLogP of 5.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dichlorophenyl)-3-(4-methyl-3-nitrophenyl)-5-(trifluoromethyl)-4H-1,2-oxazole is sourced from PubChem (CID 59355619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).