C18H13Cl2F3N2O2 — CID 59355651
N-[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]formamide (PubChem CID 59355651) has the molecular formula C18H13Cl2F3N2O2 and a molecular weight of 417.21 g/mol. Its IUPAC name is N-[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]formamide.
| Compound Name | N-[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]formamide |
|---|---|
| PubChem CID | 59355651 |
| Molecular Formula | C18H13Cl2F3N2O2 |
| Molecular Weight | 417.21 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | N-[5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]formamide |
| SMILES | Cc1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1NC=O |
| InChI | InChI=1S/C18H13Cl2F3N2O2/c1-10-2-3-11(4-15(10)24-9-26)16-8-17(27-25-16,18(21,22)23)12-5-13(19)7-14(20)6-12/h2-7,9H,8H2,1H3,(H,24,26) |
| InChIKey | HCXZEYKZSBZIJM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.21 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|