About 2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline
2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline (PubChem CID 59355663) has the molecular formula C16H10Cl3F3N2O
and a molecular weight of 409.62 g/mol. Its IUPAC name is 2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline.
Molecular Properties
| Compound Name | 2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline |
| PubChem CID | 59355663 |
| Molecular Formula | C16H10Cl3F3N2O |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline |
| SMILES | Nc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1Cl |
| InChI | InChI=1S/C16H10Cl3F3N2O/c17-10-4-9(5-11(18)6-10)15(16(20,21)22)7-14(24-25-15)8-1-2-12(19)13(23)3-8/h1-6H,7,23H2 |
| InChIKey | TYVCDUMMLXFCFY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline?
The IUPAC name of 2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline (CID 59355663) is 2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline.
What is the SMILES notation for 2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline?
The canonical SMILES for 2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline is Nc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1Cl.
What is the InChIKey of 2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline?
The InChIKey is TYVCDUMMLXFCFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10Cl3F3N2O/c17-10-4-9(5-11(18)6-10)15(16(20,21)22)7-14(24-25-15)8-1-2-12(19)13(23)3-8/h1-6H,7,23H2.
What are the key properties of 2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline?
2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline has a molecular weight of 409.62 g/mol, XLogP of 5.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]aniline is sourced from PubChem (CID 59355663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).