About methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate
methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate (PubChem CID 59355888) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate.
Molecular Properties
| Compound Name | methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate |
| PubChem CID | 59355888 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate |
| SMILES | COC(=O)C(CC1CC1)[C@@H]1c2ccccc2C[C@H]1N |
| InChI | InChI=1S/C16H21NO2/c1-19-16(18)13(8-10-6-7-10)15-12-5-3-2-4-11(12)9-14(15)17/h2-5,10,13-15H,6-9,17H2,1H3/t13?,14-,15+/m1/s1 |
| InChIKey | IKVSMXVKDLRHHY-DMJDIKPUSA-N |
| XLogP | 2.24 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate?
The IUPAC name of methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate (CID 59355888) is methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate.
What is the SMILES notation for methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate?
The canonical SMILES for methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate is COC(=O)C(CC1CC1)[C@@H]1c2ccccc2C[C@H]1N.
What is the InChIKey of methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate?
The InChIKey is IKVSMXVKDLRHHY-DMJDIKPUSA-N. The full InChI is InChI=1S/C16H21NO2/c1-19-16(18)13(8-10-6-7-10)15-12-5-3-2-4-11(12)9-14(15)17/h2-5,10,13-15H,6-9,17H2,1H3/t13?,14-,15+/m1/s1.
What are the key properties of methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate?
methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate has a molecular weight of 259.35 g/mol, XLogP of 2.24, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1R,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-3-cyclopropylpropanoate is sourced from PubChem (CID 59355888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).