C18H25NO5 — CID 59355898
dimethyl 2-[(1S,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-2-(2-ethoxyethyl)propanedioate (PubChem CID 59355898) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is dimethyl 2-[(1S,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-2-(2-ethoxyethyl)propanedioate.
| Compound Name | dimethyl 2-[(1S,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-2-(2-ethoxyethyl)propanedioate |
|---|---|
| PubChem CID | 59355898 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | dimethyl 2-[(1S,2R)-2-amino-2,3-dihydro-1H-inden-1-yl]-2-(2-ethoxyethyl)propanedioate |
| SMILES | CCOCCC(C(=O)OC)(C(=O)OC)[C@@H]1c2ccccc2C[C@H]1N |
| InChI | InChI=1S/C18H25NO5/c1-4-24-10-9-18(16(20)22-2,17(21)23-3)15-13-8-6-5-7-12(13)11-14(15)19/h5-8,14-15H,4,9-11,19H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | DGJZMWDSDBWHIJ-HUUCEWRRSA-N |
| XLogP | 1.41 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|