About 5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid
5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid (PubChem CID 59355984) has the molecular formula C18H21BrO3S
and a molecular weight of 397.33 g/mol. Its IUPAC name is 5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid |
| PubChem CID | 59355984 |
| Molecular Formula | C18H21BrO3S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid |
| SMILES | Cc1cc(OC(CC(C)C)c2ccc(C(=O)O)s2)cc(C)c1Br |
| InChI | InChI=1S/C18H21BrO3S/c1-10(2)7-14(15-5-6-16(23-15)18(20)21)22-13-8-11(3)17(19)12(4)9-13/h5-6,8-10,14H,7H2,1-4H3,(H,20,21) |
| InChIKey | XBGHLYFPQBIUHS-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid?
The IUPAC name of 5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid (CID 59355984) is 5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid?
The canonical SMILES for 5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid is Cc1cc(OC(CC(C)C)c2ccc(C(=O)O)s2)cc(C)c1Br.
What is the InChIKey of 5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid?
The InChIKey is XBGHLYFPQBIUHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21BrO3S/c1-10(2)7-14(15-5-6-16(23-15)18(20)21)22-13-8-11(3)17(19)12(4)9-13/h5-6,8-10,14H,7H2,1-4H3,(H,20,21).
What are the key properties of 5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid?
5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid has a molecular weight of 397.33 g/mol, XLogP of 5.99, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(4-bromo-3,5-dimethylphenoxy)-3-methylbutyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 59355984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).