C16H28O4 — CID 59356093
12-hydroxy-2,2,11,11-tetramethyl-5,8-dioxododecanal (PubChem CID 59356093) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is 12-hydroxy-2,2,11,11-tetramethyl-5,8-dioxododecanal.
| Compound Name | 12-hydroxy-2,2,11,11-tetramethyl-5,8-dioxododecanal |
|---|---|
| PubChem CID | 59356093 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 12-hydroxy-2,2,11,11-tetramethyl-5,8-dioxododecanal |
| SMILES | CC(C)(C=O)CCC(=O)CCC(=O)CCC(C)(C)CO |
| InChI | InChI=1S/C16H28O4/c1-15(2,11-17)9-7-13(19)5-6-14(20)8-10-16(3,4)12-18/h11,18H,5-10,12H2,1-4H3 |
| InChIKey | OQGZSCNWYLEGAG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|