C15H19F2NO3 — CID 59356128
3,5-difluoro-N-[(1-hydroxycyclohexyl)methyl]-4-methoxybenzamide (PubChem CID 59356128) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is 3,5-difluoro-N-[(1-hydroxycyclohexyl)methyl]-4-methoxybenzamide.
| Compound Name | 3,5-difluoro-N-[(1-hydroxycyclohexyl)methyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 59356128 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3,5-difluoro-N-[(1-hydroxycyclohexyl)methyl]-4-methoxybenzamide |
| SMILES | COc1c(F)cc(C(=O)NCC2(O)CCCCC2)cc1F |
| InChI | InChI=1S/C15H19F2NO3/c1-21-13-11(16)7-10(8-12(13)17)14(19)18-9-15(20)5-3-2-4-6-15/h7-8,20H,2-6,9H2,1H3,(H,18,19) |
| InChIKey | HSEFFLQCQAHEAO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |