About [1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite
[1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite (PubChem CID 59356233) has the molecular formula C12H19FN2O4S
and a molecular weight of 306.36 g/mol. Its IUPAC name is [1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite.
Molecular Properties
| Compound Name | [1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite |
| PubChem CID | 59356233 |
| Molecular Formula | C12H19FN2O4S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite |
| SMILES | CCOCCNC(=O)CCCN1C(=O)CC(SF)C1=O |
| InChI | InChI=1S/C12H19FN2O4S/c1-2-19-7-5-14-10(16)4-3-6-15-11(17)8-9(20-13)12(15)18/h9H,2-8H2,1H3,(H,14,16) |
| InChIKey | SURSGTQEYDKSLN-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite?
The IUPAC name of [1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite (CID 59356233) is [1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite.
What is the SMILES notation for [1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite?
The canonical SMILES for [1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite is CCOCCNC(=O)CCCN1C(=O)CC(SF)C1=O.
What is the InChIKey of [1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite?
The InChIKey is SURSGTQEYDKSLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19FN2O4S/c1-2-19-7-5-14-10(16)4-3-6-15-11(17)8-9(20-13)12(15)18/h9H,2-8H2,1H3,(H,14,16).
What are the key properties of [1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite?
[1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite has a molecular weight of 306.36 g/mol, XLogP of 0.66, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(2-ethoxyethylamino)-4-oxobutyl]-2,5-dioxopyrrolidin-3-yl] thiohypofluorite is sourced from PubChem (CID 59356233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).