About (4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide
(4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide (PubChem CID 59356508) has the molecular formula C16H23F2NO2
and a molecular weight of 299.36 g/mol. Its IUPAC name is (4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide.
Molecular Properties
| Compound Name | (4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide |
| PubChem CID | 59356508 |
| Molecular Formula | C16H23F2NO2 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide |
| SMILES | CCC[C@H](C)C(O)C(F)(F)C(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C16H23F2NO2/c1-4-8-11(2)14(20)16(17,18)15(21)19-12(3)13-9-6-5-7-10-13/h5-7,9-12,14,20H,4,8H2,1-3H3,(H,19,21)/t11-,12-,14?/m0/s1 |
| InChIKey | ZGROLKYUDWAXLS-VHBIQUBJSA-N |
| XLogP | 3.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide?
The IUPAC name of (4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide (CID 59356508) is (4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide.
What is the SMILES notation for (4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide?
The canonical SMILES for (4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide is CCC[C@H](C)C(O)C(F)(F)C(=O)N[C@@H](C)c1ccccc1.
What is the InChIKey of (4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide?
The InChIKey is ZGROLKYUDWAXLS-VHBIQUBJSA-N. The full InChI is InChI=1S/C16H23F2NO2/c1-4-8-11(2)14(20)16(17,18)15(21)19-12(3)13-9-6-5-7-10-13/h5-7,9-12,14,20H,4,8H2,1-3H3,(H,19,21)/t11-,12-,14?/m0/s1.
What are the key properties of (4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide?
(4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide has a molecular weight of 299.36 g/mol, XLogP of 3.30, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide is sourced from PubChem (CID 59356508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).