About 1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate
1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate (PubChem CID 59356583) has the molecular formula C16H30N2O4
and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate |
| PubChem CID | 59356583 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1CC(NCC(C)C)CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H30N2O4/c1-11(2)8-17-13-7-12(14(19)21-6)9-18(10-13)15(20)22-16(3,4)5/h11-13,17H,7-10H2,1-6H3 |
| InChIKey | ONUXPROPUGGHJY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate?
The IUPAC name of 1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate (CID 59356583) is 1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate.
What is the SMILES notation for 1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate?
The canonical SMILES for 1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate is COC(=O)C1CC(NCC(C)C)CN(C(=O)OC(C)(C)C)C1.
What is the InChIKey of 1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate?
The InChIKey is ONUXPROPUGGHJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O4/c1-11(2)8-17-13-7-12(14(19)21-6)9-18(10-13)15(20)22-16(3,4)5/h11-13,17H,7-10H2,1-6H3.
What are the key properties of 1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate?
1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate has a molecular weight of 314.43 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 3-O-methyl 5-(2-methylpropylamino)piperidine-1,3-dicarboxylate is sourced from PubChem (CID 59356583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).