About 2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine
2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine (PubChem CID 59356840) has the molecular formula C22H14I2N2
and a molecular weight of 560.18 g/mol. Its IUPAC name is 2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine.
Molecular Properties
| Compound Name | 2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine |
| PubChem CID | 59356840 |
| Molecular Formula | C22H14I2N2 |
| Molecular Weight | 560.18 g/mol |
| Exact Mass | 559.92 |
| IUPAC Name | 2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine |
| SMILES | Cc1ccc(C#Cc2cc(C#Cc3ccc(C)cn3)c(I)cc2I)nc1 |
| InChI | InChI=1S/C22H14I2N2/c1-15-3-7-19(25-13-15)9-5-17-11-18(22(24)12-21(17)23)6-10-20-8-4-16(2)14-26-20/h3-4,7-8,11-14H,1-2H3 |
| InChIKey | IKWSTZRJTFYGNH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.18 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine?
The IUPAC name of 2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine (CID 59356840) is 2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine.
What is the SMILES notation for 2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine?
The canonical SMILES for 2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine is Cc1ccc(C#Cc2cc(C#Cc3ccc(C)cn3)c(I)cc2I)nc1.
What is the InChIKey of 2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine?
The InChIKey is IKWSTZRJTFYGNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14I2N2/c1-15-3-7-19(25-13-15)9-5-17-11-18(22(24)12-21(17)23)6-10-20-8-4-16(2)14-26-20/h3-4,7-8,11-14H,1-2H3.
What are the key properties of 2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine?
2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine has a molecular weight of 560.18 g/mol, XLogP of 5.10, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2,4-diiodo-5-[2-(5-methyl-2-pyridinyl)ethynyl]phenyl]ethynyl]-5-methylpyridine is sourced from PubChem (CID 59356840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).