C33H26F6N6Pt — CID 59357077
6-[1,3-diphenyl-2-[6-[(4,4,4-trifluoro-3-iminobut-1-enyl)amino]-2-pyridinyl]propan-2-yl]-N-(4,4,4-trifluoro-3-iminobut-1-enyl)pyridin-2-amine;platinum(2+) (PubChem CID 59357077) has the molecular formula C33H26F6N6Pt and a molecular weight of 815.68 g/mol. Its IUPAC name is 6-[1,3-diphenyl-2-[6-[(4,4,4-trifluoro-3-iminobut-1-enyl)amino]-2-pyridinyl]propan-2-yl]-N-(4,4,4-trifluoro-3-iminobut-1-enyl)pyridin-2-amine;platinum(2+).
| Compound Name | 6-[1,3-diphenyl-2-[6-[(4,4,4-trifluoro-3-iminobut-1-enyl)amino]-2-pyridinyl]propan-2-yl]-N-(4,4,4-trifluoro-3-iminobut-1-enyl)pyridin-2-amine;platinum(2+) |
|---|---|
| PubChem CID | 59357077 |
| Molecular Formula | C33H26F6N6Pt |
| Molecular Weight | 815.68 g/mol |
| Exact Mass | 815.18 |
| IUPAC Name | 6-[1,3-diphenyl-2-[6-[(4,4,4-trifluoro-3-iminobut-1-enyl)amino]-2-pyridinyl]propan-2-yl]-N-(4,4,4-trifluoro-3-iminobut-1-enyl)pyridin-2-amine;platinum(2+) |
| SMILES | [H]/N=C(\C=[C-]/Nc1cccc(C(Cc2ccccc2)(Cc2ccccc2)c2cccc(N/[C-]=C\C(=N/[H])C(F)(F)F)n2)n1)C(F)(F)F.[Pt+2] |
| InChI | InChI=1S/C33H26F6N6.Pt/c34-32(35,36)25(40)17-19-42-29-15-7-13-27(44-29)31(21-23-9-3-1-4-10-23,22-24-11-5-2-6-12-24)28-14-8-16-30(45-28)43-20-18-26(41)33(37,38)39;/h1-18,40-41H,21-22H2,(H,42,44)(H,43,45);/q-2;+2/b40-25+,41-26+; |
| InChIKey | VNLXRVHPUUJJIV-CHZVUFBVSA-N |
| XLogP | 7.87 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.68 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|