C50H30F4N4 — CID 59357219
9-[6-(3,6-Difluorocarbazol-9-yl)-9,10-bis(5-methyl-2-pyridinyl)anthracen-2-yl]-3,6-difluorocarbazole (PubChem CID 59357219) has the molecular formula C50H30F4N4 and a molecular weight of 762.80 g/mol. Its IUPAC name is 9-[6-(3,6-difluorocarbazol-9-yl)-9,10-bis(5-methyl-2-pyridinyl)anthracen-2-yl]-3,6-difluorocarbazole.
| Compound Name | 9-[6-(3,6-Difluorocarbazol-9-yl)-9,10-bis(5-methyl-2-pyridinyl)anthracen-2-yl]-3,6-difluorocarbazole |
|---|---|
| PubChem CID | 59357219 |
| Molecular Formula | C50H30F4N4 |
| Molecular Weight | 762.80 g/mol |
| Exact Mass | 762.24 |
| IUPAC Name | 9-[6-(3,6-difluorocarbazol-9-yl)-9,10-bis(5-methyl-2-pyridinyl)anthracen-2-yl]-3,6-difluorocarbazole |
| SMILES | CC1=CN=C(C=C1)C2=C3C=C(C=CC3=C(C4=C2C=CC(=C4)N5C6=C(C=C(C=C6)F)C7=C5C=CC(=C7)F)C8=NC=C(C=C8)C)N9C1=C(C=C(C=C1)F)C1=C9C=CC(=C1)F |
| InChI | InChI=1S/C50H30F4N4/c1-27-3-13-43(55-25-27)49-35-11-9-34(58-47-17-7-31(53)21-39(47)40-22-32(54)8-18-48(40)58)24-42(35)50(44-14-4-28(2)26-56-44)36-12-10-33(23-41(36)49)57-45-15-5-29(51)19-37(45)38-20-30(52)6-16-46(38)57/h3-26H,1-2H3 |
| InChIKey | MZEFZMXKUHXDTB-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 35.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | 1280 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.80 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|