C56H42F4N4 — CID 59357236
9-[9,10-bis(5-tert-butyl-2-pyridinyl)-6-(3,6-difluorocarbazol-9-yl)anthracen-2-yl]-3,6-difluorocarbazole (PubChem CID 59357236) has the molecular formula C56H42F4N4 and a molecular weight of 846.97 g/mol. Its IUPAC name is 9-[9,10-bis(5-tert-butyl-2-pyridinyl)-6-(3,6-difluorocarbazol-9-yl)anthracen-2-yl]-3,6-difluorocarbazole.
| Compound Name | 9-[9,10-bis(5-tert-butyl-2-pyridinyl)-6-(3,6-difluorocarbazol-9-yl)anthracen-2-yl]-3,6-difluorocarbazole |
|---|---|
| PubChem CID | 59357236 |
| Molecular Formula | C56H42F4N4 |
| Molecular Weight | 846.97 g/mol |
| Exact Mass | 846.33 |
| IUPAC Name | 9-[9,10-bis(5-tert-butyl-2-pyridinyl)-6-(3,6-difluorocarbazol-9-yl)anthracen-2-yl]-3,6-difluorocarbazole |
| SMILES | CC(C)(C)c1ccc(-c2c3ccc(-n4c5ccc(F)cc5c5cc(F)ccc54)cc3c(-c3ccc(C(C)(C)C)cn3)c3ccc(-n4c5ccc(F)cc5c5cc(F)ccc54)cc23)nc1 |
| InChI | InChI=1S/C56H42F4N4/c1-55(2,3)31-7-17-47(61-29-31)53-39-15-13-38(64-51-21-11-35(59)25-43(51)44-26-36(60)12-22-52(44)64)28-46(39)54(48-18-8-32(30-62-48)56(4,5)6)40-16-14-37(27-45(40)53)63-49-19-9-33(57)23-41(49)42-24-34(58)10-20-50(42)63/h7-30H,1-6H3 |
| InChIKey | WGCAPBMZSYRLET-UHFFFAOYSA-N |
| XLogP | 15.46 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.97 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|