About dimethylsilylmethyl-methyl-dipropoxysilane
dimethylsilylmethyl-methyl-dipropoxysilane (PubChem CID 59357366) has the molecular formula C10H26O2Si2
and a molecular weight of 234.49 g/mol. Its IUPAC name is dimethylsilylmethyl-methyl-dipropoxysilane.
Molecular Properties
| Compound Name | dimethylsilylmethyl-methyl-dipropoxysilane |
| PubChem CID | 59357366 |
| Molecular Formula | C10H26O2Si2 |
| Molecular Weight | 234.49 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | dimethylsilylmethyl-methyl-dipropoxysilane |
| SMILES | CCCO[Si](C)(C[SiH](C)C)OCCC |
| InChI | InChI=1S/C10H26O2Si2/c1-6-8-11-14(5,10-13(3)4)12-9-7-2/h13H,6-10H2,1-5H3 |
| InChIKey | CUKZFHBDSIUSGN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethylsilylmethyl-methyl-dipropoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsilylmethyl-methyl-dipropoxysilane?
The IUPAC name of dimethylsilylmethyl-methyl-dipropoxysilane (CID 59357366) is dimethylsilylmethyl-methyl-dipropoxysilane.
What is the SMILES notation for dimethylsilylmethyl-methyl-dipropoxysilane?
The canonical SMILES for dimethylsilylmethyl-methyl-dipropoxysilane is CCCO[Si](C)(C[SiH](C)C)OCCC.
What is the InChIKey of dimethylsilylmethyl-methyl-dipropoxysilane?
The InChIKey is CUKZFHBDSIUSGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H26O2Si2/c1-6-8-11-14(5,10-13(3)4)12-9-7-2/h13H,6-10H2,1-5H3.
What are the key properties of dimethylsilylmethyl-methyl-dipropoxysilane?
dimethylsilylmethyl-methyl-dipropoxysilane has a molecular weight of 234.49 g/mol, XLogP of 2.94, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsilylmethyl-methyl-dipropoxysilane is sourced from PubChem (CID 59357366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).