About methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate
methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate (PubChem CID 593575) has the molecular formula C5H8N4O2
and a molecular weight of 156.15 g/mol. Its IUPAC name is methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| PubChem CID | 593575 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate |
| SMILES | COC(=O)Cn1cnc(N)n1 |
| InChI | InChI=1S/C5H8N4O2/c1-11-4(10)2-9-3-7-5(6)8-9/h3H,2H2,1H3,(H2,6,8) |
| InChIKey | PVZAEPWNPMKAPJ-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The IUPAC name of methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate (CID 593575) is methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate.
What is the SMILES notation for methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The canonical SMILES for methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate is COC(=O)Cn1cnc(N)n1.
What is the InChIKey of methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
The InChIKey is PVZAEPWNPMKAPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O2/c1-11-4(10)2-9-3-7-5(6)8-9/h3H,2H2,1H3,(H2,6,8).
What are the key properties of methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate?
methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate has a molecular weight of 156.15 g/mol, XLogP of -0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3-amino-1,2,4-triazol-1-yl)acetate is sourced from PubChem (CID 593575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).