C36H21IrN4S- — CID 59358297
CID 59358297 (PubChem CID 59358297) has the molecular formula C36H21IrN4S- and a molecular weight of 733.88 g/mol.
| Compound Name | CID 59358297 |
|---|---|
| PubChem CID | 59358297 |
| Molecular Formula | C36H21IrN4S- |
| Molecular Weight | 733.88 g/mol |
| Exact Mass | 734.11 |
| IUPAC Name | — |
| SMILES | [Ir].[c-]1cccc2c3cscc3c3c(-c4cccc(-c5ccc6c(c5)c5ccccc5n6-c5ccccn5)c4)cnn3c12 |
| InChI | InChI=1S/C36H21N4S.Ir/c1-3-12-32-26(10-1)28-19-24(15-16-33(28)39(32)35-14-5-6-17-37-35)23-8-7-9-25(18-23)29-20-38-40-34-13-4-2-11-27(34)30-21-41-22-31(30)36(29)40;/h1-12,14-22H;/q-1; |
| InChIKey | ZAXKGQKJKKYZOW-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 35.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.88 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|