About CID 59358299
CID 59358299 (PubChem CID 59358299) has the molecular formula C37H20IrN3OS-
and a molecular weight of 746.87 g/mol.
Molecular Properties
| Compound Name | CID 59358299 |
| PubChem CID | 59358299 |
| Molecular Formula | C37H20IrN3OS- |
| Molecular Weight | 746.87 g/mol |
| Exact Mass | 747.10 |
| IUPAC Name | — |
| SMILES | [Ir].[c-]1csc2c3cc(-c4ccc5oc6ccc(-n7c8ccccc8c8ccccc87)cc6c5c4)ccc3c3ccnn3c12 |
| InChI | InChI=1S/C37H20N3OS.Ir/c1-3-7-31-25(5-1)26-6-2-4-8-32(26)39(31)24-11-14-36-29(21-24)28-19-23(10-13-35(28)41-36)22-9-12-27-30(20-22)37-34(16-18-42-37)40-33(27)15-17-38-40;/h1-15,17-21H;/q-1; |
| InChIKey | RYKYBMNCIFZNQE-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 35.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 746.87 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 59358299 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59358299?
The IUPAC name of CID 59358299 (CID 59358299) is not available.
What is the SMILES notation for CID 59358299?
The canonical SMILES for CID 59358299 is [Ir].[c-]1csc2c3cc(-c4ccc5oc6ccc(-n7c8ccccc8c8ccccc87)cc6c5c4)ccc3c3ccnn3c12.
What is the InChIKey of CID 59358299?
The InChIKey is RYKYBMNCIFZNQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C37H20N3OS.Ir/c1-3-7-31-25(5-1)26-6-2-4-8-32(26)39(31)24-11-14-36-29(21-24)28-19-23(10-13-35(28)41-36)22-9-12-27-30(20-22)37-34(16-18-42-37)40-33(27)15-17-38-40;/h1-15,17-21H;/q-1;.
What are the key properties of CID 59358299?
CID 59358299 has a molecular weight of 746.87 g/mol, XLogP of 10.16, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59358299 is sourced from PubChem (CID 59358299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).