C30H16F6IrN3- — CID 59358324
3-(2-carbazol-9-yl-1,1,1,3,3,3-hexafluoropropan-2-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium (PubChem CID 59358324) has the molecular formula C30H16F6IrN3- and a molecular weight of 724.68 g/mol. Its IUPAC name is 3-(2-carbazol-9-yl-1,1,1,3,3,3-hexafluoropropan-2-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium.
| Compound Name | 3-(2-carbazol-9-yl-1,1,1,3,3,3-hexafluoropropan-2-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium |
|---|---|
| PubChem CID | 59358324 |
| Molecular Formula | C30H16F6IrN3- |
| Molecular Weight | 724.68 g/mol |
| Exact Mass | 725.09 |
| IUPAC Name | 3-(2-carbazol-9-yl-1,1,1,3,3,3-hexafluoropropan-2-yl)-11H-pyrazolo[1,5-f]phenanthridin-11-ide;iridium |
| SMILES | FC(F)(F)C(c1cnn2c3[c-]cccc3c3ccccc3c12)(n1c2ccccc2c2ccccc21)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C30H16F6N3.Ir/c31-29(32,33)28(30(34,35)36,38-24-14-6-3-11-20(24)21-12-4-7-15-25(21)38)23-17-37-39-26-16-8-5-10-19(26)18-9-1-2-13-22(18)27(23)39;/h1-15,17H;/q-1; |
| InChIKey | GNAFBPAMPWTACZ-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 22.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.68 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|